Task Group on Atmospheric Chemical Kinetic Data Evaluation

Data sheets for reactions of gas-phase organic peroxy radicals

This is the list of currently available data sheets for reactions of gas-phase organic peroxy radicals
A zip file containing all of the PDF format datasheets for this category is available : iupac_organics_roo.zip.  Please do not redistribute these datasheets or zipfile. They are for personal use only.
Our ID
ACP ID
ReactantsProductsFormatsLast change in
preferred values
Last evaluated
ROO_1
II.A6.120
CH3O2 + NO
CH3O2 + NO + M
CH3O + NO2
CH3ONO2 + M
PDF   Word  2005-07-03  2013-06-01
ROO_2
C2H5O2 + NO
C2O5O2 + NO + M
C2H5O + NO2
C2H5ONO2 + M
PDF   Word  2005-07-03  2005-07-03
ROO_3
HOCH2CH2O2 + NOHOCH2CH2O + NO2PDF   Word  2002-11-12  2002-11-12
ROO_4
n-C3H7O2
n-C3H7O2 + NO + M
n-C3H7O + NO2
n-C3H7ONO2 + M
PDF   Word  2005-07-03  2005-07-03
ROO_5
i-C3H7O2 + NO
i-C3H7O2 + NO + M
i-C3H7O + NO2
i-C3H7ONO2 + M
PDF   Word  2005-07-03  2005-07-03
ROO_6
CH3C(O)CH2O2 + NOCH3C(O)CH2O + NO2PDF   Word  2006-11-22  2006-11-22
ROO_7
CH3C(O)OO + NOCH3C(O)O + NO2PDF   Word  2002-11-12  2002-11-12
ROO_8
C2H5C(O)OO + NOC2H5C(O)O + NO2PDF   Word  2002-11-12  2002-11-12
ROO_9
II.A6.128
CH3O2 + NO2 + MCH3O2NO2 + MPDF   Word  2003-06-12  2009-06-04
ROO_10
II.A6.129
CH3O2NO2 + MCH3O2 + NO2 + MPDF   Word  2003-06-12  2009-06-04
ROO_11
II.A6.130
C2H5O2 + NO2 + MC2H5O2NO2 + MPDF   Word  2003-06-12  2009-06-04
ROO_12
II.A6.131
C2H5O2NO2 + MC2H5O2 + NO2 + MPDF   Word  2003-06-12  2009-06-04
ROO_13
CH3C(O)CH2O2 + NO2CH3C(O)CH2O2NO2PDF   Word  2006-11-24  2006-11-24
ROO_14
II.A6.132
CH3C(O)O2 + NO2 + MCH3C(O)O2NO2 + MPDF   Word  2003-06-12  2009-06-04
ROO_15
II.A6.133
CH3C(O)O2NO2 + MCH3C(O)O2 + NO2 + MPDF   Word  2003-06-12  2009-06-04
ROO_16
II.A6.134
C2H5C(O)O2NO2 + MC2H5C(O)O2 + NO2 + MPDF   Word  2003-06-12  2003-06-12
ROO_17
CH3C(O)CH2O2NO2 + MCH3C(O)CH2O2 + NO2 + MPDF   Word  2005-12-19  2005-12-19
ROO_18
CH2=C(CH3)C(O)OONO2 + MCH2=C(CH3)CO3 + NO2 + MPDF   Word  2002-11-12  2002-11-12
ROO_19
CH3O2 + NO3 + MCH3O + NO2 + O2
other products
PDF   Word  2008-08-16  2008-08-16
ROO_20
C2H5O2 + NO3 + MC2H5O + NO2 + O2
other products
PDF   Word  2008-08-16  2008-08-16
ROO_21
0000
CH3C(O)OO + NO3CH3CO2 + NO2 + O2PDF   Word  2008-09-12  2008-09-12
ROO_22
0000
CH3O2 + CH3O2CH3OH + HCHO + O2
2CH3O + O2
CH3OOCH3 + O2
PDF   Word  2002-11-12  2002-11-12
ROO_23
0000
CH3O2 + CH3C(O)OOCH3O + CH3C(O)O + O2
CH3C(O)OH + HCHO + O2
PDF   Word  2002-11-12  2002-11-12
ROO_24
0000
CH3O2 + CH3C(O)CH2O2CH3OH + CH3C(O)CHO + O2
HCHO + CH3C(O)CH2OH + O2
CH3O + CH3C(O)CH2O + O2
PDF   Word  2002-11-12  2002-11-12
ROO_25
0000
HOCH2O2 + HOCH2O2HC(O)OH + CH2(OH)2 + O2
2HOCH2O + O2
PDF   Word  2002-11-12  2002-11-12
ROO_26
II.A6.143
C2H5O2 + C2H5O2 C2H5O + C2H5O + O2
C2H5OH + CH3CHO + O2
C2H5OOC2H5 + O2
PDF   Word  2011-06-01  2011-06-01
ROO_27
0000
C2H5O2 + CH3C(O)OOC2H5O + CH3C(O)O + O
CH3CHO + CH3C(O)OH + O2
PDF   Word  2002-11-12  2002-11-12
ROO_28
0000
CH3OCH2O2 + CH3OCH2O2CH3OCH2OH + CH3OCHO + O2
2CH3OCH2O + O2
PDF   Word  2005-02-17  2005-02-17
ROO_29
0000
CH3C(O)O2 + CH3C(O)O22CH3C(O)O + O2PDF   Word  2002-11-12  2002-11-12
ROO_30
0000
CH3C(O)O2 + CH3C(O)CH2O2CH3C(O)OH + CH3C(O)CHO + O2
CH3C(O)O + CH3C(O)CH2O + O2
PDF   Word  2002-11-12  2002-11-12
ROO_31
0000
HOCH2CH2O2 + HOCH2CH2O2HOCH2CH2OH + HOCH2CHO + O2
2HOCH2CH2O + O2
PDF   Word  2002-11-12  2002-11-12
ROO_32
0000
n-C3H7O2 + n-C3H7O2n-C3H7OH + C2H5CHO + O2
2 n-C3H7O + O2
PDF   Word  2002-11-12  2002-11-12
ROO_33
0000
i-C3H7O2 + i-C3H7O2i-C3H7OH + CH3C(O)CH3 + O2
2 i-C3H7O + O2
PDF   Word  2002-11-12  2002-11-12
ROO_34
0000
CH3C(O)CH2O2 + CH3COCH2O2CH3C(O)CH2OH + CH3C(O)CHO + O2
2 CH3C(O)CH2O + O2
PDF   Word  2005-02-17  2005-02-17
ROO_35
0000
RCHOO + reactantsRCHO + 2O2PDF   Word  2013-05-01  2013-05-01
ROO_36
0000
HOCH2O2 + NOHOCH2O + NO2PDF   Word  2009-09-01  2009-09-01
ROO_37
t-C4H9O2 + NO
t-C4H9O2 + NO + M
C4H9O + 1-NO2
C4H9ONO2 + M
PDF   Word  2010-06-01  2010-06-01
ROO_38
(CH3)2C(OH)CH2O2 + NO(CH3)2C(OH)CH2O + NO2
(CH3)2C(OH)CH2ONO2 + M
PDF   Word  2010-06-01  2010-06-01
ROO_41
0000
CH3O2 + C2H5O2CH3O + C2H5O + O2
CH3OH + C2H5CHO + O2
HCHO + C2H5OH + O2
PDF   Word  2009-09-01  2009-09-01
ROO_42
t-C4H9O2 + t-C4H9O22t-C4H9O + O2
t-C4H9OOt-C4H9 + O2
PDF   Word  2011-06-01  2011-06-01
ROO_43
CH3O2 + t-C4H9O2CH3O + t-C4H9O + O2
HCHO + t-C4H9OH + O2
PDF   Word  2011-06-01  2011-06-01
ROO_44
2 CH3CH(OH)CH(O2)CH32CH3CH(OH)CH(O)CH3 + O2
CH3CH(OH)C(O)CH3 + CH3CH(OH)CH(OH)CH3 + O2
PDF   Word  2011-06-01  2011-06-01
ROO_46
2 (CH3)2C(OH)CH2O22(CH3)2C(OH)CH2O + O2
(CH3)2C(OH)CHO + (CH3)2C(OH)CH2OH + O2
PDF   Word  2011-06-01  2011-06-01
ROO_47
0000
C2H5C(O)O2 + C2H5C(O)O22C2H5C(O)O + O2PDF   Word  2009-03-05  2009-03-05
ROO_48
0000
C2H5C(O)O2 + C2H5O2C2H5O + C2H5C(O)O + O2
CH3CHO + C2H5C(O)OH + O2
PDF   Word  2009-03-05  2009-03-05
ROO_49
CH3CH(OH)CH(O2)CH3 + NOCH3CH(OH)CH(O)CH3 + NO2
CH3CH(OH)CH(ONO2)CH3 + M
PDF   Word  2010-06-01  2010-06-01
ROO_50
HOC5H8O2 + NOHOC5H8O + NO2
HOC5H8ONO2 + M
PDF   Word  2010-06-01  2010-06-01

This website is designed, maintained, and hosted by Ether. The information contained in the website (images, text) may be downloaded for personal use. It may not be retransmitted or disseminated either electronically, or in hardcopy, without explicit written permission. ©