Task Group on Atmospheric Chemical Kinetic Data Evaluation

Summary Pressure Independent

This page is currently under construction. It will gradually and automatically be filled as part of ongoing work, and may therefore contain errors and omissions. Please consult the relevant datasheets for the latest evaluations.



ID Reactions k298
cm³ molecule-1s-1
Δlogk Temp. dependence of k/cm³ molecule-1s-1 Δ(E/R)/ka Temperature range
HOx1H + HO2H2 + O2
HO + HO
H2O + O   
k = 8.0E-11
k1 = 5.6E-12
k2 = 7.2E-11
k3 = 2.4E-12
± 0.1
± 0.5
± 0.1
± 0.5
k = 8.0E-11
k1 = 5.6E-12
k2 = 7.2E-11
k3 = 2.4E-12
± 200



245-300



HOx_AROM1HO + benzeneH2O + C6H5 (1)
HOC6H6 (2)   
k = 1.2E-12
k1 = 8.0E-15
k2 = k - k1
± 0.10
± 0.5

k = 2.3E-12*EXP(-190/T)
k1 = 3.8E-11*EXP(-2520/T)
k2 = k - k1
± 200
± 300

230-350
330-1410

HOx_AROM10HO + 3-methyl-2-nitrophenolproducts   3.7E-12± 0.3
HOx_AROM11HO + 4-methyl-2-nitrophenolproducts   3.6E-12± 0.15
HOx_AROM12HO + 5-methyl-2-nitrophenolproducts   6.7E-12± 0.2
HOx_AROM13HO + 6-methyl-2-nitrophenolproducts   2.8E-12± 0.3
HOx_AROM14HO + 1,4-benzoquinoneproducts   4.6E-12± 0.15
HOx_AROM15HO + methyl-1,4-benzoquinoneproducts   2.3E-11± 0.15
HOx_AROM16HO + nitrobenzeneproducts   1.4E-13± 0.26.0E-13*EXP(-440/T)± 300250-370
HOx_AROM17HO + 3-nitrotolueneproducts   1.2E-12± 0.5
HOx_AROM18HO + cis-but-2-enedialproducts   5.8E-11± 0.2
HOx_AROM19HO + trans-but-2-enedialproducts   ≥ 2E-11
HOx_AROM2HO + tolueneH2O + C6H5CH2 (1)
HOC6H5CH3 (2)   
k = 5.6E-12
k1 = 3.5E-13
k2 = k - k1
± 0.10
± 0.20

k = 1.8E-12*EXP(340/T)
k1 = 2.5E-11*EXP(-1270/T)
k2 = k - k1
± 200
± 200

210-350
310-1050

HOx_AROM20HO + 3H-furan-2-oneproducts   4.9E-11± 0.2
HOx_AROM21HO + furan-2,5-dioneproducts   1.4E-12± 0.2
HOx_AROM22HO + 4-oxopent-2-enalproducts   6.2E-11± 0.2
HOx_AROM25HO + benzaldehydeproducts   1.26E-11± 0.085.9E-12*EXP(225/T)± 170290-350
HOx_AROM26HO + benzyl alcoholproducts   2.7E-11± 0.2
HOx_AROM3HO + m-cresolH2O + CH3C6H4O (1)
H2O + CH2C6H4OH (2)
CH3C6H4(OH)2 (3)   
k = 5.9E-11± 0.15k = 2.3E-12*EXP(965/T)± 600290-350
HOx_AROM4HO + o-cresolH2O + CH3C6H4O (1)
H2O + CH2C6H4OH (2)
CH3C6H4(OH)2 (3)   
k = 4.1E-11± 0.15k = 1.6E-12*EXP(970/T)± 600290-350
HOx_AROM5HO + p-cresolH2O + CH3C6H4O (1)
H2O + CH2C6H4OH (2)
CH3C6H4(OH)2 (3)   
k = 4.9E-11± 0.15k = 1.9E-12*EXP(970/T)± 600290-350
HOx_AROM6HO + phenolH2O + C6H5O (1)
H2O + C6H4OH (2)
HOC6H5OH (3)   
k = 2.8E-11± 0.15k = 4.7E-13*EXP(1220/T)± 600290-350
HOx_AROM7HO + 1,2-benzenediolproducts   1.0E-10± 0.15
HOx_AROM8HO + 1,2-dihydroxy-3-methylbenzeneproducts   2.0E-10± 0.15
HOx_AROM9HO + 1,2-dihydroxy-4-methylbenzeneproducts   1.5E-10± 0.15
HOx_VOC1HO + CH4H2O + CH3   6.4E-15± 0.061.85E-12*exp(-1690/T)± 100200-300
HOx_VOC100HO + limoneneproducts   1.65E-10± 0.053.41E-11 exp(470/T)± 150
HOx_VOC107HO + α-farneseneproducts   2.2E-10± 0.3
HOx_VOC108HO + β-farneseneproducts   2.3E-10± 0.3
HOx_VOC11HO + HCHOH2O + HCO   8.5E-12± 0.085.4E-12*exp(135/T)± 100200-300
HOx_VOC12HO + CH3CHOH2O + CH3CO (1)
H2O + CH2CHO (2)   
k = 1.5E-11
k1 =k*0.95
k2 = k*0.05
± 0.06


k = 4.7E-12*exp(345/T)


± 80


200-380


HOx_VOC13HO + C2H5CHOproducts   1.9E-11± 0.14.9E-12 exp(405/T)± 200240-380
HOx_VOC14HO + CH3CH2CH2CHOproducts   2.4E-11± 0.16.0E-12*exp(410/T)± 250250-430
HOx_VOC15HO + CH2=C(CH3)CHOproducts   2.9E-11± 0.18.0E-12*exp(380/T)± 200230-380
HOx_VOC16HO + (CHO)2products   9.7E-12± 0.13.1E-12*exp(340/T)± 200200-300
HOx_VOC17HO + HOCH2CHOH2O + HOCH2CO (1)
H2O + HOCHCHO (2)   
k = 8.0E-12
k1 = k*0.8
k2 = k*0.2
± 0.15


k = 8.0E-12


not given


240-370


HOx_VOC18HO + CH3C(O)CHOH2O + CH3C(O)CO   1.3E-11± 0.151.9E-12*exp(575/T)± 300220-410
HOx_VOC19HO + CH3C(O)CH3H2O + CH3C(O)CH2   1.8E-13± 0.088.8E-12*exp(-1320/T) + 1.7E-14*exp(423/T)Δlog k = ± 0.08195-440
HOx_VOC20HO + CH3C(O)CH2CH3products   1.1E-12± 0.11.5E-12*exp(-90/T)± 200210-300
HOx_VOC21HO + CH2=CHC(O)CH3products   2.0E-11± 0.12.6E-12*exp(610/T)± 200230-380
HOx_VOC22HO + pinonaldehydeproducts   3.9E-11± 0.155.2E-12*exp(600/T)± 300290-380
HOx_VOC23HO + CH3OHH2O + CH2OH (1)
H2O + CH3O (2)   
k = 9.0E-13
k1 = k*0.85
k2 = k*0.15
± 0.08


k = 2.85E-12*exp(-345/T)


± 150 K


210-300


HOx_VOC24HO + C2H5OHH2O + CH2CH2OH (1)
H2O + CH3CHOH (2)
H2O + C2H5O (3)   
k = 3.2E-12
k1 = k*0.05
k2 = k*0.90
k3 = k*0.05
± 0.06



k = 3.0E-12*exp(20/T)



± 100



210-300



HOx_VOC25HO + CH3CH2CH2OHproducts   5.8E-12± 0.14.6E-12*exp(70/T)± 100260-380
HOx_VOC26HO + CH3CH(OH)CH3H2O + (CH3)2CHO (1)
H2O + CH3C(OH)CH3 (2)
H2O + CH3CH(OH)CH2 (3)   
k = 5.1E-12± 0.08k = 2.6E-12*exp(200/T)
± 100250-360
HOx_VOC27HO + CH3CH2CH2CH2OHproducts   8.5E-12± 0.155.3E-12*exp(140/T)± 200260-380
HOx_VOC28HO + CH3CH(OH)CH2CH3products   8.7E-12± 0.15
HOx_VOC29HO + (CH3)2C(OH)CH=CH2products   6.3E-11± 0.18.1E-12*exp(610/T)± 200 K230-300
HOx_VOC30HO + CH3OCH3H2O + CH3OCH2   2.8E-12± 0.085.7E-12*exp(-215/T)± 100230-300
HOx_VOC31HO + [-CH=CHC(CH3)=CHO-] (3-methylfuran)products   9.3E-11± 0.3
HOx_VOC32HO + CH3C(O)CH2OHproducts   4.5E-12± 0.251.6E-12*exp(305/T)± 200230-370
HOx_VOC33HO + (CH3)2C(OH)CHOproducts   1.4E-11± 0.2
HOx_VOC34HO + CH3OOHH2O + CH2OOH (1)
H2O + CH3O2 (2)   
k = 1.0E-11
k1 = k*0.4
k2 = k*0.6
± 0.3


k = 5.3E-12*exp(190/T)
k1 = k*0.4
k2 = k*0.6
± 200


220-430


HOx_VOC35HO + HC(O)OHproducts   4.5E-13± 0.154.5E-13± 250290-450
HOx_VOC36HO + CH3C(O)OHH2O + CH2C(O)OH (1)
H2O + CH3C(O)O (2)   
k = 6.9E-13± 0.1k = 4.0E-14*exp(850/T)± 250 K220-300
HOx_VOC37HO + C2H5C(O)OHproducts   1.2E-12± 0.21.2E-12± 300290-450
HOx_VOC38HO + CH3ONO2products   2.3E-14+ 0.5- 0.24.0E-13*exp(-845/T)± 400 K220-300
HOx_VOC39HO + C2H5ONO2products   1.8E-13± 0.36.7E-13*exp(-395/T)± 400230-300
HOx_VOC4HO + C2H6H2O + C2H5   2.4E-13± 0.086.9E-12*exp(-1000/T)± 100200-300
HOx_VOC40HO + 1-C3H7ONO2products   5.8E-13± 0.3
HOx_VOC41HO + 2-C3H7ONO2products   2.9E-13± 0.26.2E-13*exp(-230/T)± 300230-300
HOx_VOC42HO + 1-C4H9ONO2products   1.6E-12± 0.2
HOx_VOC43HO + 2-C4H9ONO2products   8.6E-13± 0.3
HOx_VOC44HO + CH3C(O)OONO2products   < 3E-14
HOx_VOC45HO + CH2C(O)CH2ONO2products   < 1E-12
HOx_VOC46HO + CH3CH2C(O)CH2ONO2products   8.2E-13± 0.3
HOx_VOC47HO + CH3CH(ONO2)C(O)CH3products   1.2E-12± 0.3
HOx_VOC48HO + CH2=C(CH3)C(O)OONO2products   2.9E-11+ 0.2- 0.5
HOx_VOC49HO + HCNproducts   3.0E-14± 0.51.2E-13*exp(-400/T)± 300290-440
HOx_VOC50HO + CH3CNproducts   2.2E-14± 0.158.1E-13*exp(-1080/T)± 200250-390
HOx_VOC51HO2 + CH3O2O2 + CH3OOH (1)
O2 + HCHO + H2O (2)   
k = 5.2E-12
k1 = k*0.9
k2 = k*0.1
± 0.2


k = 3.8E-13*exp(780/T)
k1 = (k-k2)
k2 = k/(1+ 498*exp(-1160/T))
± 200

± 500
220-298
HOx_VOC54HO2 + CH3C(O)O2O2 + CH3C(O)OOH (1)
O3 + CH3C(O)OH (2)
O2 + HO + CH3C(O)O (3)   
k = 2.2E-11
k1 = k*0.37
k2 = k*0.13
k3 = k*0.50
± 0.2



k = 3.14E-12*exp(580/T)
k1 (see datasheet)
k2 (see datasheet)
k3 (see datasheet)
± 400



250-300
HOx_VOC6HO + C3H8H2O + CH3CH2CH2 (1)
H2O + CH3CHCH3 (2)   
k = 1.1E-12± 0.08k = 7.6E-12*exp(-585/T)± 100200-300
HOx_VOC60HO + (CH3)3CHH2O + (CH3)3C (1)
H2O + (CH3)2CHCH3 (2)   
k = 2.1E-12± 0.08k = 5.4E-12*exp(-285/T)± 150210-300
HOx_VOC61HO + (CH3)2C=CHproducts   5.1E-11± 0.19.4E-12*exp(505/T)± 200290-430
HOx_VOC62HO + CH3CH2CH=CH2products   3.1E-11± 0.086.6E-12*exp(465/T)± 150290-430
HOx_VOC63HO + cis-CH3CH=CHCH3products   5.6E-11± 0.11.1E-11*exp(485/T)± 200290-430
HOx_VOC64HO + trans-CH3CH=CHCH3products   6.4E-11± 0.11.0E-11*exp(553/T)± 200290-430
HOx_VOC65HO + C2H5OOHH2O + CH3CHOOH (1)
H2O + CH2CH2OOH (2)
H2O + C2H5O2 (3)   
k > 6E-12
HOx_VOC66HO + CH3C(O)C(O)CHCH3products   2.3E-13± 0.15.25E-13*exp(-243/T)± 50240-350
HOx_VOC67HO + n-C3H7C(O)OHproducts   1.8E-12± 0.3
HOx_VOC68HO + i-C3H7CHOproducts   2.6E-11± 0.16.8E-12*exp(410/T)± 60240-425
HOx_VOC69HO + i-C4H9OHproducts   8.9E-12± 0.082.73E-12*exp(352/T)± 120240-370
HOx_VOC7HO + CH3CH2CH2CH3H2O + CH2CH2CH2CH3 (1)
H2O + CH3CHCH2CH3 (2)   
k = 2.35E-12± 0.06k = 9.8E-12*exp(-425/T)± 100180-300
HOx_VOC70t-C4H9OHproducts   1.1E-12± 0.081.6E-12*exp(-121/T)± 75240-314
HOx_VOC71HO + HOCH2CH2OHproducts   1.45E-11± 0.2
HOx_VOC72HO + CH3CH(OH)CHOproducts   1.7E-11± 0.2
HOx_VOC73HO + CH3CH(OH)CH2OHproducts   2.1E-11± 0.2
Hox_VOC74HO + CH3CH(ONO2)CH2OHproducts   6.7E-12± 0.2
HOx_VOC75HO + CH3CH(OH)CH2ONO2products   5.1E-12± 0.2
HOx_VOC76HO + C2H5CH(OH)CHOproducts   2.4E-11± 0.1
HOx_VOC77HO + C2H5CH(OH)CH2ONO2products   7.0E-12± 0.2
HOx_VOC78HO + C2H5CH(ONO2)CH2OHproducts   7.4E-12± 0.2
HOx_VOC79HO + CH3C(O)CH(OH)CH3products   9.7E-12± 0.11.24E-12*exp(612/T)± 350280-350
HOx_VOC8HO + CH2=C(CH3)CH=CH2products   1.0E-10± 0.062.7E-11*exp(390/T)± 100240-430
HOx_VOC84HO + α-terpineneproducts   3.5E-10± 0.08
HOx_VOC85HO + γ-terpineneproducts   1.7E-10± 0.1
HOx_VOC86HO + terpinoleneproducts   2.2E-10± 0.15
HOx_VOC87HO + α-phellandreneproducts   3.2E-10± 0.08
HOx_VOC88HO + β-phellandreneproducts   1.7E-10± 0.15
HOx_VOC89HO + α-cedreneproducts   6.7E-11± 0.1
HOx_VOC9HO + α-pineneproducts   5.3E-11± 0.081.34E-11*exp(410/T)± 100240-360
HOx_VOC90HO + longifoleneproducts   4.7E-11± 0.15
HOx_VOC91HO + α-copaeneproduct   ** check **** check **
HOx_VOC92HO + β-caryophylleneproducts   2.0E-10± 0.15
HOx_VOC93HO + α-humuleneproducts   2.9E-10± 0.1
HOx_VOC97HO + CH3C(O)C(O)OHproducts   1.2E-13± 0.24.9E-14*exp (280/T)± 150260-380
HOx_VOC98HO + CH3C(O)OOHCH3C(O)O2 + H2O (1)
CH2C(O)OOH + H2O (2)   
k = 1.1E-11
k1 = k*0.5
k2 = k*0.5
± 0.3


HOx_VOC99HO + β-pineneproducts   7.6E-11± 0.051.62E-11 exp(460/T)± 150240-420
NO3_AROM1NO3 + benzeneproducts   < 3E-17
NO3_AROM2NO3 + tolueneproducts   7.8E-17± 0.25
NO3_AROM3NO3 + m-cresolHNO3 + CH3C6H4O (1)
other products (2)   
k = 1.0E-11± 0.15
NO3_AROM4NO3 + o-cresolHNO3 + CH3C6H4O (1)
other products (2)   
k = 1.4E-11± 0.15
NO3_AROM5NO3 + p-cresolHNO3 + CH3C6H4O (1)
other products (2)   
k = 1.1E-11± 0.15
NO3_AROM6NO3 + phenolHNO3 + C6H5O (1)
other products (2)   
k = 3.8E-12± 0.15
NO3_AROM7NO3 + 1,2-benzenediolproducts   9.9E-11± 0.15
NO3_AROM8NO3 + 1,2-dihydroxy-3-methylbenzeneproducts   1.7E-10± 0.15
NO3_AROM9NO3 + 1,2-dihydroxy-4-methylbenzeneproducts   1.5E-10± 0.15
NO3_VOC1NO3 + CH4HNO3 + CH3   < 1E-18
NO3_VOC10NO3 + HCHOHNO3 + HCO   5.5E-16± 0.2
NO3_VOC11NO3 + CH3CHOHNO3 + CH3CO   2.7E-15± 0.151.4E-12*exp(-1860/T)± 500260-380
NO3_VOC12NO3 + C2H5CHOproducts   6.3E-15± 0.15
NO3_VOC13NO3 + CH3C(O)CH3HNO3 + CH3C(O)CH2   < 3E-17
NO3_VOC14NO3 + CH3CH2CH2CHOproducts   1.1E-14± 0.151.7E-12*exp(-1500/T)± 500
NO3_VOC15NO3 + (CH3)2CHCHOproducts   1.25E-14± 0.21.67E-12*exp(-1460/T)± 300
NO3_VOC16NO3 + CH2=C(CH3)CHOproducts   3.4E-15± 0.15
NO3_VOC17NO3 + CH2=CHC(O)CH3products   < 6E-16
NO3_VOC18NO3 + pinonaldehydeproducts   2.0E-14± 0.25
NO3_VOC19NO3 + [-CH=CHC(CH3)=CHO-] (3-methylfuran)products   1.9E-11± 0.5
NO3_VOC2NO3 + C2H2products   < 1E-16
NO3_VOC20NO3 + CH2=C(CH3)C(O)OONO2products   1.6E-16± 0.7
NO3_VOC21NO3 + CH3OHproducts   1.3E-16± 0.59.4E-13*exp(-2650/T)± 700250-370
NO3_VOC22NO3 + C2H5OHproducts   < 2E-15
NO3_VOC23NO3 + CH3CH(OH)CH3HNO3 + CH3C(OH)CH3 (1)
HNO3 + CH2CH(OH)CH3 (2)   
k = 1.4E-15
k1 = k*1.0
k2 = k*0.0
± 0.3


NO3_VOC24NO3 + CH3CH(OH)CH2CH3HNO3 + CH3C(OH)CH2CH3 (1)
HNO3 + CH2CH(OH)CH2CH3 (2)
HNO3 + CH3CH(OH)CHCH3 (3)
HNO3 + CH3CH(OH)CH   
k = 2.0E-15
k1 = k*1.0
k2 = k*0.0
k3 = k*0.0
k4 = k*0.0
± 0.3




NO3_VOC25NO3 + (CH3)2C(OH)CH=CH2products   1.2E-14± 0.24.6E-14*exp(-400/T)± 200260-400
NO3_VOC26NO3 + (CH3)3CHproducts   1.1E-16± 0.153.0E-12*exp(-3050/T)± 300290-430
NO3_VOC27NO3 + (CH3)2C=CH2products   3.4E-13± 0.1
NO3_VOC28NO3 + CH3CH2CH=CH2products   1.3E-14± 0.13.2E-13*exp(-950/T)± 200290-480
NO3_VOC29NO3 + cis-CH3CH=CHCH3products   3.5E-13± 0.15
NO3_VOC3NO3 + C2H4products   2.1E-16± 0.23.3E-12*exp(-2880/T)± 500270-340
NO3_VOC30NO3 + trans-CH3CH=CHCH3products   3.9E-13± 0.081.78E-12*exp(-530/T) + 1.28E-14*exp(570/T)not given200-380
NO3_VOC33NO3 + d-limoneneproducts   1.2E-11± 0.12
NO3_VOC34NO3 + 2-careneproducts   2.0E-11± 0.12
NO3_VOC35NO3 + 3-careneproducts   9.1E-12± 0.12
NO3_VOC36NO3 + β-pineneproducts   2.5E-12± 0.12
NO3_VOC37NO3 + myrceneproducts   1.1E-11± 0.12
NO3_VOC38NO3 + sabineneproducts   1.0E-11± 0.1
NO3_VOC39NO3 + ocimeneproducts   2.2E-11± 0.15
NO3_VOC4NO3 + C2H6HNO3 + C2H5   < 1E-17
NO3_VOC40NO3 + α-terpineneproducts   1.8E-10± 0.25
NO3_VOC41NO3 + γ-terpineneproducts   2.9E-11± 0.12
NO3_VOC42NO3 + α-phellandreneproducts   7.3E-11± 0.15
NO3_VOC43NO3 + terpinoleneproducts   9.7E-11± 0.25
NO3_VOC44NO3 + (HCO)2HNO3 + HC(O)CO   4.0E-16± 0.154.0E-16not given290-350
NO3_VOC45NO3 + CH3C(O)CHOHNO3 + CH3C(O)CO   5.0E-16± 0.3
NO3_VOC46NO3 + campheneproducts   6.6E-13± 0.1
NO3_VOC47NO3 + β-caryophylleneproducts   1.9E-11± 0.25
NO3_VOC48NO3 + α-cedreneproducts   8.2E-12± 0.25
NO3_VOC49NO3 + α-humuleneproucts   3.5E-11± 0.25
NO3_VOC5NO3 + C3H6products   9.5E-15± 0.24.6E-13*exp(-1155/T)± 300290-430
NO3_VOC50NO3 + α-copaeneproducts   1.6E-11± 0.25
NO3_VOC51NO3 + longifoleneproducts   6.8E-13± 0.25
NO3_VOC52NO3 + isolongifoleneproducts   3.9E-12± 0.25
NO3_VOC53NO3 + alloisolongifoleneproducts   1.4E-12± 0.25
NO3_VOC54NO3 + α-neocloveneproducts   8.25E-12± 0.25
NO3_VOC55NO3 + valenceneproducts   7.9E-12± 0.25
NO3_VOC56NO3 + α-terpineolproducts   1.7E-11± 0.15
NO3_VOC6NO3 + C3H8HNO3 + CH3CH2CH2 (1)
HNO3 + CH3CHCH3 (2)   
k < 7E-17
NO3_VOC7NO3 + n-C4H10products   4.6E-17± 0.22.8E-12*exp(-3280/T)± 400290-430
NO3_VOC8NO3 + isopreneproducts   6.5E-13± 0.152.95E-12*exp(-450/T)± 200250-390
NO3_VOC9NO3 + α-pineneproducts   6.2E-12± 0.11.2E-12*exp(490/T)± 300290-450
Ox2O + O3O2 + O2   8.0E-15± 0.088.0E-12*exp(-2060/T)± 200200-400
Ox_AROM1O3 + benzeneproducts   < 1E-21
Ox_AROM2O3 + tolueneproducts   < 1E-21
Ox_AROM3O3 + m-cresolproducts   1.9E-19± 0.3
Ox_AROM4O3 + o-cresolproducts   2.6E-19± 0.3
Ox_AROM5O3 + p-cresolproducts   4.7E-19± 0.3
Ox_AROM6O3 + 1,2-dihydroxybenzeneproducts   9.2E-18± 0.15
Ox_AROM7O3 + 1,2-dihydroxy-3-methylbenzeneproducts   2.8E-17± 0.15
Ox_AROM8O3 + 1,2-dihydroxy-4-methylbenzeneproducts   2.6E-17± 0.15
Ox_VOC15O3 + (CH3)2C=CH2products   1.15E-17± 0.052.92E-15*exp(-1650/T)± 200220-370
Ox_VOC16O3 + CH3CH2CH=CH2products   1.0E-17± 0.083.55E-15*exp(-1750/T)± 200220-370
Ox_VOC17O3 + cis-CH3CH=CHCH3products   1.3E-16± 0.053.37E-15*exp(-970/T)± 200220-370
Ox_VOC18O3 + trans-CH3CH=CHCH3products   2.0E-16± 0.17.0E-15*exp(-1060/T)± 200220-370
Ox_VOC19O3 + β-pineneproducts   1.9E-17± 0.251.39E-15*exp(-1280/T)± 300290-370
Ox_VOC20O3 + limoneneproducts   2.2E-16± 0.12.91E-15*exp(-770/T)± 300290-370
Ox_VOC21O3 + campheneproducts   5.0E-19± 0.39.0E-18*exp(-860/T)± 500285-315
Ox_VOC22O3 + 2-careneproducts   2.4E-16± 0.2
Ox_VOC23O3 + 3-careneproducts   4.8E-17± 0.2
Ox_VOC24O3 + β-myrceneproducts   4.7E-16± 0.22.69E-15*exp(-520/T)± 300290-320
Ox_VOC25O3 + β-ocimeneproducts   5.1E-16± 0.24.15E-15*exp(-625/T)± 300290-320
Ox_VOC26O3 + α-phellandreneproducts   2.9E-15± 0.2
Ox_VOC27O3 + β-phellandreneproducts   5.2E-17± 0.3
Ox_VOC28O3 + sabineneproducts   8.3E-17± 0.15
Ox_VOC29O3 + α-terpineneproducts   1.9E-14± 0.2
Ox_VOC30O3 + γ-terpineneproducts   1.6E-16± 0.3
Ox_VOC31O3 + terpinoleneproducts   1.6E-15± 0.15
Ox_VOC32O3 + β-caryophylleneproducts   1.2E-14± 0.15
OX_VOC34O3 + α-copaeneproducts   1.5E-16± 0.3
Ox_VOC35O3 + α-farneseneproducts   5.9E-16± 0.33.5E-12*exp(-2590/T)± 500290-320
Ox_VOC36O3 + β-farneseneproducts   5.6E-16±0.251.5e-12*exp(-2350/T)500290-320
Ox_VOC37O3 + α-humuleneproducts   1.2E-14± 0.15
Ox_VOC38O3 + isolongifoleneproducts   1.0E-17± 0.3
Ox_VOC39O3 + longifoleneproducts   < 5E-19-
Ox_VOC4O3 + C2H2products   1.0E-20± 0.5
Ox_VOC41O3 + 2,3-dimethylbut-2-eneproducts   1.1E-15± 0.083.0E-15*exp(-300/T)± 200220-370
Ox_VOC5O3 + C2H4products   1.55E-18± 0.086.82E-15*exp(-2500/T)± 100180-360
Ox_VOC6O3 + C3H6products   1.05E-17± 0.155.77E-15*exp(-1880/T)± 100230-370
Ox_VOC7O3 + CH2=C(CH3)CH=CH2products   1.28E-17± 0.081.05E-14*exp(-2000/T)± 200240-360
Ox_VOC8O3 + α-pineneproducts   9.6E-17± 0.158.22E-16*exp(-640/T)± 300240-370