Task Group on Atmospheric Chemical Kinetic Data Evaluation

Summary Pressure Independent

This page is currently under construction. It will gradually and automatically be filled as part of ongoing work, and may therefore contain errors and omissions. Please consult the relevant datasheets for the latest evaluations.



ID Reactions k298
cm³ molecule-1s-1
Δlogk Temp. dependence of k/cm³ molecule-1s-1 Δ(E/R)/ka Temperature range
HOx1H + HO2H2 + O2
HO + HO
H2O + O   
k = 8.0E-11
k1 = 5.6E-12
k2 = 7.2E-11
k3 = 2.4E-12
± 0.1
± 0.5
± 0.1
± 0.5
k = 8.0E-11
k1 = 5.6E-12
k2 = 7.2E-11
k3 = 2.4E-12
± 200



245-300



HOx_VOC1HO + CH4H2O + CH3   6.4E-15± 0.061.85E-12*exp(-1690/T)± 100200-300
HOx_VOC100HO + limoneneproducts   1.65E-10± 0.053.41E-11 exp(470/T)± 150
HOx_VOC107HO + α-farneseneproducts   2.2E-10± 0.3
HOx_VOC108HO + β-farneseneproducts   2.3E-10± 0.3
HOx_VOC11HO + HCHOH2O + HCO   8.5E-12± 0.085.4E-12*exp(135/T)± 100200-300
HOx_VOC12HO + CH3CHOH2O + CH3CO (1)
H2O + CH2CHO (2)   
k = 1.5E-11
k1 =k*0.95
k2 = k*0.05
± 0.06


4.7E-12*exp(345/T)


± 80


200-380


HOx_VOC13HO + C2H5CHOproducts   1.9E-11± 0.14.9E-12 exp(405/T)± 200240-380
HOx_VOC14HO + CH3CH2CH2CHOproducts   2.4E-11± 0.16.0E-12*exp(410/T)± 250250-430
HOx_VOC15HO + CH2=C(CH3)CHOproducts   2.9E-11± 0.18.0E-12*exp(380/T)± 200230-380
HOx_VOC16HO + (CHO)2products   9.7E-12± 0.13.1E-12*exp(340/T)± 200200-300
HOx_VOC17HO + HOCH2CHOH2O + HOCH2CO (1)
H2O + HOCHCHO (2)   
k = 8.0E-12
k1 = k*0.8
k2 = k*0.2
± 0.15


8.0E-12


not given


240-370


HOx_VOC18HO + CH3C(O)CHOH2O + CH3C(O)CO   1.3E-11± 0.151.9E-12*exp(575/T)± 300220-410
HOx_VOC19HO + CH3C(O)CH3H2O + CH3C(O)CH2   1.8E-13± 0.088.8E-12*exp(-1320/T) + 1.7E-14*exp(423/T)Δlog k = ± 0.08195-440
HOx_VOC20HO + CH3C(O)CH2CH3products   1.1E-12± 0.11.5E-12*exp(-90/T)± 200210-300
HOx_VOC21HO + CH2=CHC(O)CH3products   2.0E-11± 0.12.6E-12*exp(610/T)± 200230-380
HOx_VOC22HO + pinonaldehydeproducts   3.9E-11± 0.155.2E-12*exp(600/T)± 300290-380
HOx_VOC23HO + CH3OHH2O + CH2OH (1)
H2O + CH3O (2)   
k = 9.0E-13
k1 = k*0.85
k2 = k*0.15
± 0.08


2.85E-12*exp(-345/T)


± 150 K


210-300


HOx_VOC24HO + C2H5OHH2O + CH2CH2OH (1)
H2O + CH3CHOH (2)
H2O + C2H5O (3)   
k = 3.2E-12
k1 = k*0.05
k2 = k*0.90
k3 = k*0.05
± 0.06



3.0E-12*exp(20/T)



± 100



210-300



HOx_VOC25HO + CH3CH2CH2OHproducts   5.8E-12± 0.14.6E-12*exp(70/T)± 100260-380
HOx_VOC26HO + CH3CH(OH)CH3H2O + (CH3)2CHO (1)
H2O + CH3C(OH)CH3 (2)
H2O + CH3CH(OH)CH2 (3)   
k = 5.1E-12


± 0.08


2.6E-12*exp(200/T)


± 100


250-360


HOx_VOC27HO + CH3CH2CH2CH2OHproducts   8.5E-12± 0.155.3E-12*exp(140/T)± 200260-380
HOx_VOC28HO + CH3CH(OH)CH2CH3products   8.7E-12± 0.15
HOx_VOC29HO + (CH3)2C(OH)CH=CH2products   6.3E-11± 0.18.1E-12*exp(610/T)± 200 K230-300
HOx_VOC30HO + CH3OCH3H2O + CH3OCH2   2.8E-12± 0.085.7E-12*exp(-215/T)± 100230-300
HOx_VOC31HO + [-CH=CHC(CH3)=CHO-] (3-methylfuran)products   9.3E-11± 0.3
HOx_VOC32HO + CH3C(O)CH2OHproducts   4.5E-12± 0.251.6E-12*exp(305/T)± 200230-370
HOx_VOC33HO + (CH3)2C(OH)CHOproducts   1.4E-11± 0.2
HOx_VOC34HO + CH3OOHH2O + CH2OOH (1)
H2O + CH3O2 (2)   
k = 1.0E-11
k1 = k*0.4
k2 = k*0.6
± 0.3


k = 5.3E-12*exp(190/T)
k1 = k*0.4
k2 = k*0.6
± 200


220-430


HOx_VOC35HO + HC(O)OHproducts   4.5E-13± 0.154.5E-13± 250290-450
HOx_VOC36HO + CH3C(O)OHH2O + CH2C(O)OH (1)
H2O + CH3C(O)O (2)   
6.9E-13

± 0.1

4.0E-14*exp(850/T)

± 250 K

220-300

HOx_VOC37HO + C2H5C(O)OHproducts   1.2E-12± 0.21.2E-12± 300290-450
HOx_VOC38HO + CH3ONO2products   2.3E-14+ 0.5- 0.24.0E-13*exp(-845/T)± 400 K220-300
HOx_VOC39HO + C2H5ONO2products   1.8E-13± 0.36.7E-13*exp(-395/T)± 400230-300
HOx_VOC4HO + C2H6H2O + C2H5   2.4E-13± 0.086.9E-12*exp(-1000/T)± 100200-300
HOx_VOC40HO + 1-C3H7ONO2products   5.8E-13± 0.3
HOx_VOC41HO + 2-C3H7ONO2products   2.9E-13± 0.26.2E-13*exp(-230/T)± 300230-300
HOx_VOC42HO + 1-C4H9ONO2products   1.6E-12± 0.2
HOx_VOC43HO + 2-C4H9ONO2products   8.6E-13± 0.3
HOx_VOC44HO + CH3C(O)OONO2products   < 3E-14
HOx_VOC45HO + CH2C(O)CH2ONO2products   < 1E-12
HOx_VOC46HO + CH3CH2C(O)CH2ONO2products   8.2E-13± 0.3
HOx_VOC47HO + CH3CH(ONO2)C(O)CH3products   1.2E-12± 0.3
HOx_VOC48HO + CH2=C(CH3)C(O)OONO2products   2.9E-11+ 0.2- 0.5
HOx_VOC49HO + HCNproducts   3.0E-14± 0.51.2E-13*exp(-400/T)± 300290-440
HOx_VOC50HO + CH3CNproducts   2.2E-14± 0.158.1E-13*exp(-1080/T)± 200250-390
HOx_VOC51HO2 + CH3O2O2 + CH3OOH
O2 + HCHO + H2O   
k = 5.2E-12
k1 = k*0.9
k2 = k*0.1
± 0.2


k = 3.8E-13*exp(780/T)
k1 = (k-k2)
k2 = k/(1+ 498*exp(-1160/T))
± 200

± 500
220-298
HOx_VOC54HO2 + CH3C(O)O2O2 + CH3C(O)OOH
O3 + CH3C(O)OH
O2 + HO + CH3C(O)O   
k = 2.2E-11
k1 = k*0.37
k2 = k*0.13
k3 = k*0.50
± 0.2



k = 3.14E-12*exp(580/T)
k1 (see datasheet)
k2 (see datasheet)
k3 (see datasheet)
± 400



250-300
HOx_VOC6HO + C3H8H2O + CH3CH2CH2 (1)
H2O + CH3CHCH3 (2)   
k = 1.1E-12

± 0.08

7.6E-12*exp(-585/T)

± 100

200-300

HOx_VOC60HO + (CH3)3CHH2O + (CH3)3C (1)
H2O + (CH3)2CHCH3 (2)   
k = 2.1E-12

± 0.08

5.4E-12*exp(-285/T)

± 150

210-300

HOx_VOC61HO + (CH3)2C=CHproducts   5.1E-11± 0.19.4E-12*exp(505/T)± 200290-430
HOx_VOC62HO + CH3CH2CH=CH2products   3.1E-11± 0.086.6E-12*exp(465/T)± 150290-430
HOx_VOC63HO + cis-CH3CH=CHCH3products   5.6E-11± 0.11.1E-11*exp(485/T)± 200290-430
HOx_VOC64HO + trans-CH3CH=CHCH3products   6.4E-11± 0.11.0E-11*exp(553/T)± 200290-430
HOx_VOC65HO + C2H5OOHH2O + CH3CHOOH (1)
H2O + CH2CH2OOH (2)
H2O + C2H5O2 (3)   
k > 6E-12





HOx_VOC66HO + CH3C(O)C(O)CHCH3products   2.3E-13± 0.15.25E-13*exp(-243/T)± 50240-350
HOx_VOC67HO + n-C3H7C(O)OHproducts   1.8E-12± 0.3
HOx_VOC68HO + i-C3H7CHOproducts   2.6E-11± 0.16.8E-12*exp(410/T)± 60240-425
HOx_VOC69HO + i-C4H9OHproducts   8.9E-12± 0.082.73E-12*exp(352/T)± 120240-370
HOx_VOC7HO + CH3CH2CH2CH3H2O + CH2CH2CH2CH3 (1)
H2O + CH3CHCH2CH3 (2)   
k = 2.35E-12

± 0.06

9.8E-12*exp(-425/T)

± 100

180-300

HOx_VOC70t-C4H9OHproducts   1.1E-12± 0.081.6E-12*exp(-121/T)± 75240-314
HOx_VOC71HO + HOCH2CH2OHproducts   1.45E-11± 0.2
HOx_VOC72HO + CH3CH(OH)CHOproducts   1.7E-11± 0.2
HOx_VOC73HO + CH3CH(OH)CH2OHproducts   2.1E-11± 0.2
Hox_VOC74HO + CH3CH(ONO2)CH2OHproducts   6.7E-12± 0.2
HOx_VOC75HO + CH3CH(OH)CH2ONO2products   5.1E-12± 0.2
HOx_VOC76HO + C2H5CH(OH)CHOproducts   2.4E-11± 0.1
HOx_VOC77HO + C2H5CH(OH)CH2ONO2products   7.0E-12± 0.2
HOx_VOC78HO + C2H5CH(ONO2)CH2OHproducts   7.4E-12± 0.2
HOx_VOC79HO + CH3C(O)CH(OH)CH3products   9.7E-12± 0.11.24E-12*exp(612/T)± 350280-350
HOx_VOC8HO + CH2=C(CH3)CH=CH2products   1.0E-10± 0.062.7E-11*exp(390/T)± 100240-430
HOx_VOC84HO + α-terpineneproducts   3.5E-10± 0.08
HOx_VOC85HO + γ-terpineneproducts   1.7E-10± 0.1
HOx_VOC86HO + terpinoleneproducts   2.2E-10± 0.15
HOx_VOC87HO + α-phellandreneproducts   3.2E-10± 0.08
HOx_VOC88HO + β-phellandreneproducts   1.7E-10± 0.15
HOx_VOC89HO + α-cedreneproducts   6.7E-11± 0.1
HOx_VOC9HO + α-pineneproducts   5.3E-11± 0.081.34E-11*exp(410/T)± 100240-360
HOx_VOC90HO + longifoleneproducts   4.7E-11± 0.15
HOx_VOC91HO + α-copaeneproduct   ** check **** check **
HOx_VOC92HO + β-caryophylleneproducts   2.0E-10± 0.15
HOx_VOC93HO + α-humuleneproducts   2.9E-10± 0.1
HOx_VOC97HO + CH3C(O)C(O)OHproducts   1.2E-13± 0.24.9E-14*exp (280 /T)± 150260-380
HOx_VOC98HO + CH3C(O)OOHCH3C(O)O2 + H2O
CH2C(O)OOH + H2O   
k = 1.1E-11
k1 = k*0.5
k2 = k*0.5
± 0.3


HOx_VOC99HO + β-pineneproducts   7.6E-11± 0.051.62E-11 exp(460/T)± 150240-420
NO3_VOC46NO3 campheneproducts   6.6e-13±0.1
Ox2O + O3O2 + O2   8.0e-15±0.088.0e-12*exp(-2060/T)200200-400
Ox_VOC19O3 + β-pineneproducts   1.9e-17±0.251.35e-15*exp(-1270/T)300290-370
Ox_VOC20O3 + limoneneproducts   2.1e-16±0.12.8e-15*exp(-770/T)300290-370
Ox_VOC21O3 + campheneproducts   6.8e-19±0.3
Ox_VOC22O3 + 2-careneproducts   2.4e-16±0.2
Ox_VOC23O3 + 3-careneproducts   4.8e-17±0.2
Ox_VOC24O3 + β-myrceneproducts   4.6e-16±0.22.65e-15*exp(-520/T)300290-320
Ox_VOC25O3 + β-ocimeneproducts   4.9e-16±0.2
Ox_VOC26O3 + α-phellandreneproducts   3.0e-15±0.2
Ox_VOC27O3 + β-phellandreneproducts   5.0e-17±0.3
Ox_VOC28O3 + sabineneproducts   8.2e-17±0.15
Ox_VOC29O3 + α-terpineneproducts   1.9e-14±0.2
Ox_VOC30O3 + γ-terpineneproducts   1.5e-16±0.3
Ox_VOC31O3 + terpinoleneproducts   1.6e-15±0.15
Ox_VOC32O3 + β-caryophylleneproducts   1.2e-14±0.15
OX_VOC34O3 + α-copaeneproducts   1.5e-16±0.3
Ox_VOC35O3 + α-farneseneproducts   5.9e-16±0.33.5e-12*exp(-2590/T)500290-320
Ox_VOC36O3 + β-farneseneproducts   5.6e-16±0.251.5e-12*exp(-2350/T)500290-320
Ox_VOC38O3 + isolongifoleneproducts   1.0e-17±0.3
Ox_VOC39O3 + longifoleneproducts   < 5e-19-
Ox_VOC8O3 + α-pineneproducts   9.4e-17±0.158.05e-16*exp(-640/T)±300240-370